C19H23N3 — CID 142247195
3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene (PubChem CID 142247195) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene.
| Compound Name | 3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 142247195 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene |
| SMILES | Nc1nc(C2CC2)cnc1C1CC1.c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C10H13N3.C9H10/c11-10-9(7-3-4-7)12-5-8(13-10)6-1-2-6;1-2-5-9-7-3-6-8(9)4-1/h5-7H,1-4H2,(H2,11,13);1-2,4-5H,3,6-7H2 |
| InChIKey | HXDBKPSVPYWRTM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |