About 3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene
3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene (PubChem CID 142247195) has the molecular formula C19H23N3
and a molecular weight of 293.41 g/mol. Its IUPAC name is 3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene |
| PubChem CID | 142247195 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene |
| SMILES | Nc1nc(C2CC2)cnc1C1CC1.c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C10H13N3.C9H10/c11-10-9(7-3-4-7)12-5-8(13-10)6-1-2-6;1-2-5-9-7-3-6-8(9)4-1/h5-7H,1-4H2,(H2,11,13);1-2,4-5H,3,6-7H2 |
| InChIKey | HXDBKPSVPYWRTM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene?
The IUPAC name of 3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene (CID 142247195) is 3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene.
What is the SMILES notation for 3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene?
The canonical SMILES for 3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene is Nc1nc(C2CC2)cnc1C1CC1.c1ccc2c(c1)CCC2.
What is the InChIKey of 3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene?
The InChIKey is HXDBKPSVPYWRTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3.C9H10/c11-10-9(7-3-4-7)12-5-8(13-10)6-1-2-6;1-2-5-9-7-3-6-8(9)4-1/h5-7H,1-4H2,(H2,11,13);1-2,4-5H,3,6-7H2.
What are the key properties of 3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene?
3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene has a molecular weight of 293.41 g/mol, XLogP of 3.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dicyclopropylpyrazin-2-amine;2,3-dihydro-1H-indene is sourced from PubChem (CID 142247195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).