C13H18F3N — CID 142247437
4-[(2E,4Z)-3-(trifluoromethyl)hepta-2,4-dien-4-yl]-1,2,3,6-tetrahydropyridine (PubChem CID 142247437) has the molecular formula C13H18F3N and a molecular weight of 245.29 g/mol. Its IUPAC name is 4-[(2E,4Z)-3-(trifluoromethyl)hepta-2,4-dien-4-yl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-[(2E,4Z)-3-(trifluoromethyl)hepta-2,4-dien-4-yl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 142247437 |
| Molecular Formula | C13H18F3N |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 4-[(2E,4Z)-3-(trifluoromethyl)hepta-2,4-dien-4-yl]-1,2,3,6-tetrahydropyridine |
| SMILES | C/C=C(C(=C/CC)\C1=CCNCC1)/C(F)(F)F |
| InChI | InChI=1S/C13H18F3N/c1-3-5-11(10-6-8-17-9-7-10)12(4-2)13(14,15)16/h4-6,17H,3,7-9H2,1-2H3/b11-5-,12-4+ |
| InChIKey | DYEAFNNUQSSRHF-FYXNRHCTSA-N |
| XLogP | 3.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|