C35H42FN3O — CID 142247936
acetamide;3-[4-[1-(cyclopropylmethyl)-4-ethenylpiperidin-4-yl]phenyl]benzonitrile;4-ethyl-1-fluoro-2-methylbenzene (PubChem CID 142247936) has the molecular formula C35H42FN3O and a molecular weight of 539.74 g/mol. Its IUPAC name is acetamide;3-[4-[1-(cyclopropylmethyl)-4-ethenylpiperidin-4-yl]phenyl]benzonitrile;4-ethyl-1-fluoro-2-methylbenzene.
| Compound Name | acetamide;3-[4-[1-(cyclopropylmethyl)-4-ethenylpiperidin-4-yl]phenyl]benzonitrile;4-ethyl-1-fluoro-2-methylbenzene |
|---|---|
| PubChem CID | 142247936 |
| Molecular Formula | C35H42FN3O |
| Molecular Weight | 539.74 g/mol |
| Exact Mass | 539.33 |
| IUPAC Name | acetamide;3-[4-[1-(cyclopropylmethyl)-4-ethenylpiperidin-4-yl]phenyl]benzonitrile;4-ethyl-1-fluoro-2-methylbenzene |
| SMILES | C=CC1(c2ccc(-c3cccc(C#N)c3)cc2)CCN(CC2CC2)CC1.CC(N)=O.CCc1ccc(F)c(C)c1 |
| InChI | InChI=1S/C24H26N2.C9H11F.C2H5NO/c1-2-24(12-14-26(15-13-24)18-19-6-7-19)23-10-8-21(9-11-23)22-5-3-4-20(16-22)17-25;1-3-8-4-5-9(10)7(2)6-8;1-2(3)4/h2-5,8-11,16,19H,1,6-7,12-15,18H2;4-6H,3H2,1-2H3;1H3,(H2,3,4) |
| InChIKey | AWEMXGAKSANUFR-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.74 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|