C34H39FN2S — CID 142248036
acetylene;3-[1-(cyclopropylmethyl)-4-[4-(3-methylphenyl)phenyl]piperidin-4-yl]-N-(4-fluoro-3-methylphenyl)propanethioamide (PubChem CID 142248036) has the molecular formula C34H39FN2S and a molecular weight of 526.77 g/mol. Its IUPAC name is acetylene;3-[1-(cyclopropylmethyl)-4-[4-(3-methylphenyl)phenyl]piperidin-4-yl]-N-(4-fluoro-3-methylphenyl)propanethioamide.
| Compound Name | acetylene;3-[1-(cyclopropylmethyl)-4-[4-(3-methylphenyl)phenyl]piperidin-4-yl]-N-(4-fluoro-3-methylphenyl)propanethioamide |
|---|---|
| PubChem CID | 142248036 |
| Molecular Formula | C34H39FN2S |
| Molecular Weight | 526.77 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | acetylene;3-[1-(cyclopropylmethyl)-4-[4-(3-methylphenyl)phenyl]piperidin-4-yl]-N-(4-fluoro-3-methylphenyl)propanethioamide |
| SMILES | C#C.Cc1cccc(-c2ccc(C3(CCC(=S)Nc4ccc(F)c(C)c4)CCN(CC4CC4)CC3)cc2)c1 |
| InChI | InChI=1S/C32H37FN2S.C2H2/c1-23-4-3-5-27(20-23)26-8-10-28(11-9-26)32(16-18-35(19-17-32)22-25-6-7-25)15-14-31(36)34-29-12-13-30(33)24(2)21-29;1-2/h3-5,8-13,20-21,25H,6-7,14-19,22H2,1-2H3,(H,34,36);1-2H |
| InChIKey | BIORYGKMEPRHCB-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.77 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|