C18H13F5N4O3S — CID 142249473
4-[2-(difluoromethyl)-4-ethylphenyl]-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-one (PubChem CID 142249473) has the molecular formula C18H13F5N4O3S and a molecular weight of 460.38 g/mol. Its IUPAC name is 4-[2-(difluoromethyl)-4-ethylphenyl]-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-one.
| Compound Name | 4-[2-(difluoromethyl)-4-ethylphenyl]-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 142249473 |
| Molecular Formula | C18H13F5N4O3S |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 4-[2-(difluoromethyl)-4-ethylphenyl]-3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1H-1,2,4-triazol-5-one |
| SMILES | CCc1ccc(-n2c(Sc3ccc(C(F)(F)F)cc3[N+](=O)[O-])n[nH]c2=O)c(C(F)F)c1 |
| InChI | InChI=1S/C18H13F5N4O3S/c1-2-9-3-5-12(11(7-9)15(19)20)26-16(28)24-25-17(26)31-14-6-4-10(18(21,22)23)8-13(14)27(29)30/h3-8,15H,2H2,1H3,(H,24,28) |
| InChIKey | GHAJNILMKYPHCO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|