C18H10F6N4O5S — CID 142249552
2-[4-[3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-5-oxo-1H-1,2,4-triazol-4-yl]-3-(trifluoromethyl)phenyl]acetic acid (PubChem CID 142249552) has the molecular formula C18H10F6N4O5S and a molecular weight of 508.36 g/mol. Its IUPAC name is 2-[4-[3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-5-oxo-1H-1,2,4-triazol-4-yl]-3-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-[4-[3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-5-oxo-1H-1,2,4-triazol-4-yl]-3-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 142249552 |
| Molecular Formula | C18H10F6N4O5S |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 508.03 |
| IUPAC Name | 2-[4-[3-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-5-oxo-1H-1,2,4-triazol-4-yl]-3-(trifluoromethyl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(-n2c(Sc3ccc(C(F)(F)F)cc3[N+](=O)[O-])n[nH]c2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H10F6N4O5S/c19-17(20,21)9-2-4-13(12(7-9)28(32)33)34-16-26-25-15(31)27(16)11-3-1-8(6-14(29)30)5-10(11)18(22,23)24/h1-5,7H,6H2,(H,25,31)(H,29,30) |
| InChIKey | YWLYALSRUGKJML-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|