About 1-[(3,4-difluorophenyl)methyl]-4-ethyl-3-propylimidazol-2-one;4-methylphenol
1-[(3,4-difluorophenyl)methyl]-4-ethyl-3-propylimidazol-2-one;4-methylphenol (PubChem CID 142249785) has the molecular formula C22H26F2N2O2
and a molecular weight of 388.46 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-4-ethyl-3-propylimidazol-2-one;4-methylphenol.
Molecular Properties
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-4-ethyl-3-propylimidazol-2-one;4-methylphenol |
| PubChem CID | 142249785 |
| Molecular Formula | C22H26F2N2O2 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-4-ethyl-3-propylimidazol-2-one;4-methylphenol |
| SMILES | CCCn1c(CC)cn(Cc2ccc(F)c(F)c2)c1=O.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C15H18F2N2O.C7H8O/c1-3-7-19-12(4-2)10-18(15(19)20)9-11-5-6-13(16)14(17)8-11;1-6-2-4-7(8)5-3-6/h5-6,8,10H,3-4,7,9H2,1-2H3;2-5,8H,1H3 |
| InChIKey | SURLZVGHQYHKJF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3,4-difluorophenyl)methyl]-4-ethyl-3-propylimidazol-2-one;4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-difluorophenyl)methyl]-4-ethyl-3-propylimidazol-2-one;4-methylphenol?
The IUPAC name of 1-[(3,4-difluorophenyl)methyl]-4-ethyl-3-propylimidazol-2-one;4-methylphenol (CID 142249785) is 1-[(3,4-difluorophenyl)methyl]-4-ethyl-3-propylimidazol-2-one;4-methylphenol.
What is the SMILES notation for 1-[(3,4-difluorophenyl)methyl]-4-ethyl-3-propylimidazol-2-one;4-methylphenol?
The canonical SMILES for 1-[(3,4-difluorophenyl)methyl]-4-ethyl-3-propylimidazol-2-one;4-methylphenol is CCCn1c(CC)cn(Cc2ccc(F)c(F)c2)c1=O.Cc1ccc(O)cc1.
What is the InChIKey of 1-[(3,4-difluorophenyl)methyl]-4-ethyl-3-propylimidazol-2-one;4-methylphenol?
The InChIKey is SURLZVGHQYHKJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F2N2O.C7H8O/c1-3-7-19-12(4-2)10-18(15(19)20)9-11-5-6-13(16)14(17)8-11;1-6-2-4-7(8)5-3-6/h5-6,8,10H,3-4,7,9H2,1-2H3;2-5,8H,1H3.
What are the key properties of 1-[(3,4-difluorophenyl)methyl]-4-ethyl-3-propylimidazol-2-one;4-methylphenol?
1-[(3,4-difluorophenyl)methyl]-4-ethyl-3-propylimidazol-2-one;4-methylphenol has a molecular weight of 388.46 g/mol, XLogP of 4.65, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-difluorophenyl)methyl]-4-ethyl-3-propylimidazol-2-one;4-methylphenol is sourced from PubChem (CID 142249785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).