C29H38N2O3 — CID 89293679
4-[4-[4-(3-hydroxy-2-methylbut-3-en-2-yl)oxyphenyl]butyl]-1-[(4-methylphenyl)methyl]-3-propylimidazol-2-one (PubChem CID 89293679) has the molecular formula C29H38N2O3 and a molecular weight of 462.63 g/mol. Its IUPAC name is 4-[4-[4-(3-hydroxy-2-methylbut-3-en-2-yl)oxyphenyl]butyl]-1-[(4-methylphenyl)methyl]-3-propylimidazol-2-one.
| Compound Name | 4-[4-[4-(3-hydroxy-2-methylbut-3-en-2-yl)oxyphenyl]butyl]-1-[(4-methylphenyl)methyl]-3-propylimidazol-2-one |
|---|---|
| PubChem CID | 89293679 |
| Molecular Formula | C29H38N2O3 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 4-[4-[4-(3-hydroxy-2-methylbut-3-en-2-yl)oxyphenyl]butyl]-1-[(4-methylphenyl)methyl]-3-propylimidazol-2-one |
| SMILES | C=C(O)C(C)(C)Oc1ccc(CCCCc2cn(Cc3ccc(C)cc3)c(=O)n2CCC)cc1 |
| InChI | InChI=1S/C29H38N2O3/c1-6-19-31-26(21-30(28(31)33)20-25-13-11-22(2)12-14-25)10-8-7-9-24-15-17-27(18-16-24)34-29(4,5)23(3)32/h11-18,21,32H,3,6-10,19-20H2,1-2,4-5H3 |
| InChIKey | SKPOXUPXQBDCSD-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 56.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|