C27H34N2O4 — CID 67754907
[2-[4-[(3-butyl-5-hexyl-2-oxoimidazol-1-yl)methyl]phenyl]phenyl] hydrogen carbonate (PubChem CID 67754907) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is [2-[4-[(3-butyl-5-hexyl-2-oxoimidazol-1-yl)methyl]phenyl]phenyl] hydrogen carbonate.
| Compound Name | [2-[4-[(3-butyl-5-hexyl-2-oxoimidazol-1-yl)methyl]phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67754907 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | [2-[4-[(3-butyl-5-hexyl-2-oxoimidazol-1-yl)methyl]phenyl]phenyl] hydrogen carbonate |
| SMILES | CCCCCCc1cn(CCCC)c(=O)n1Cc1ccc(-c2ccccc2OC(=O)O)cc1 |
| InChI | InChI=1S/C27H34N2O4/c1-3-5-7-8-11-23-20-28(18-6-4-2)26(30)29(23)19-21-14-16-22(17-15-21)24-12-9-10-13-25(24)33-27(31)32/h9-10,12-17,20H,3-8,11,18-19H2,1-2H3,(H,31,32) |
| InChIKey | JHVXQJKHHZXTII-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 73.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|