C28H34N6O2 — CID 54457223
4-hexyl-1-pentanoyl-3-[[4-[2-(tetrazol-1-yl)phenyl]phenyl]methyl]imidazol-2-one (PubChem CID 54457223) has the molecular formula C28H34N6O2 and a molecular weight of 486.62 g/mol. Its IUPAC name is 4-hexyl-1-pentanoyl-3-[[4-[2-(tetrazol-1-yl)phenyl]phenyl]methyl]imidazol-2-one.
| Compound Name | 4-hexyl-1-pentanoyl-3-[[4-[2-(tetrazol-1-yl)phenyl]phenyl]methyl]imidazol-2-one |
|---|---|
| PubChem CID | 54457223 |
| Molecular Formula | C28H34N6O2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 4-hexyl-1-pentanoyl-3-[[4-[2-(tetrazol-1-yl)phenyl]phenyl]methyl]imidazol-2-one |
| SMILES | CCCCCCc1cn(C(=O)CCCC)c(=O)n1Cc1ccc(-c2ccccc2-n2cnnn2)cc1 |
| InChI | InChI=1S/C28H34N6O2/c1-3-5-7-8-11-24-20-33(27(35)14-6-4-2)28(36)32(24)19-22-15-17-23(18-16-22)25-12-9-10-13-26(25)34-21-29-30-31-34/h9-10,12-13,15-18,20-21H,3-8,11,14,19H2,1-2H3 |
| InChIKey | WZBBZXTYBYIQMC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 87.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|