C28H22N6O2 — CID 54278127
1-benzoyl-4-but-3-ynyl-3-[[4-[2-(tetrazol-1-yl)phenyl]phenyl]methyl]imidazol-2-one (PubChem CID 54278127) has the molecular formula C28H22N6O2 and a molecular weight of 474.52 g/mol. Its IUPAC name is 1-benzoyl-4-but-3-ynyl-3-[[4-[2-(tetrazol-1-yl)phenyl]phenyl]methyl]imidazol-2-one.
| Compound Name | 1-benzoyl-4-but-3-ynyl-3-[[4-[2-(tetrazol-1-yl)phenyl]phenyl]methyl]imidazol-2-one |
|---|---|
| PubChem CID | 54278127 |
| Molecular Formula | C28H22N6O2 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 1-benzoyl-4-but-3-ynyl-3-[[4-[2-(tetrazol-1-yl)phenyl]phenyl]methyl]imidazol-2-one |
| SMILES | C#CCCc1cn(C(=O)c2ccccc2)c(=O)n1Cc1ccc(-c2ccccc2-n2cnnn2)cc1 |
| InChI | InChI=1S/C28H22N6O2/c1-2-3-11-24-19-33(27(35)23-9-5-4-6-10-23)28(36)32(24)18-21-14-16-22(17-15-21)25-12-7-8-13-26(25)34-20-29-30-31-34/h1,4-10,12-17,19-20H,3,11,18H2 |
| InChIKey | ROWJNTUDIIHKIR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 87.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|