C28H34N6O — CID 54060975
4-cyclohexyl-1-(3-methylbutyl)-3-[[4-[2-(tetrazol-1-yl)phenyl]phenyl]methyl]imidazol-2-one (PubChem CID 54060975) has the molecular formula C28H34N6O and a molecular weight of 470.62 g/mol. Its IUPAC name is 4-cyclohexyl-1-(3-methylbutyl)-3-[[4-[2-(tetrazol-1-yl)phenyl]phenyl]methyl]imidazol-2-one.
| Compound Name | 4-cyclohexyl-1-(3-methylbutyl)-3-[[4-[2-(tetrazol-1-yl)phenyl]phenyl]methyl]imidazol-2-one |
|---|---|
| PubChem CID | 54060975 |
| Molecular Formula | C28H34N6O |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | 4-cyclohexyl-1-(3-methylbutyl)-3-[[4-[2-(tetrazol-1-yl)phenyl]phenyl]methyl]imidazol-2-one |
| SMILES | CC(C)CCn1cc(C2CCCCC2)n(Cc2ccc(-c3ccccc3-n3cnnn3)cc2)c1=O |
| InChI | InChI=1S/C28H34N6O/c1-21(2)16-17-32-19-27(24-8-4-3-5-9-24)33(28(32)35)18-22-12-14-23(15-13-22)25-10-6-7-11-26(25)34-20-29-30-31-34/h6-7,10-15,19-21,24H,3-5,8-9,16-18H2,1-2H3 |
| InChIKey | LZRGRVIOKANNKH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 70.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |