C29H32N2O3 — CID 19910682
2-[4-[[5-but-3-ynyl-3-(2-cyclohexylethyl)-2-oxoimidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 19910682) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is 2-[4-[[5-but-3-ynyl-3-(2-cyclohexylethyl)-2-oxoimidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-but-3-ynyl-3-(2-cyclohexylethyl)-2-oxoimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19910682 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 2-[4-[[5-but-3-ynyl-3-(2-cyclohexylethyl)-2-oxoimidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | C#CCCc1cn(CCC2CCCCC2)c(=O)n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C29H32N2O3/c1-2-3-11-25-21-30(19-18-22-9-5-4-6-10-22)29(34)31(25)20-23-14-16-24(17-15-23)26-12-7-8-13-27(26)28(32)33/h1,7-8,12-17,21-22H,3-6,9-11,18-20H2,(H,32,33) |
| InChIKey | JDUBNFXYKKYONL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|