C22H27NO3 — CID 162642938
2-[4-[[pentanoyl(propan-2-yl)amino]methyl]phenyl]benzoic acid (PubChem CID 162642938) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 2-[4-[[pentanoyl(propan-2-yl)amino]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[pentanoyl(propan-2-yl)amino]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 162642938 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 2-[4-[[pentanoyl(propan-2-yl)amino]methyl]phenyl]benzoic acid |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2C(=O)O)cc1)C(C)C |
| InChI | InChI=1S/C22H27NO3/c1-4-5-10-21(24)23(16(2)3)15-17-11-13-18(14-12-17)19-8-6-7-9-20(19)22(25)26/h6-9,11-14,16H,4-5,10,15H2,1-3H3,(H,25,26) |
| InChIKey | IVWWCUUDABZYOO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |