C29H32N6O — CID 19740800
4-but-3-ynyl-1-(2-cyclohexylethyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one (PubChem CID 19740800) has the molecular formula C29H32N6O and a molecular weight of 480.62 g/mol. Its IUPAC name is 4-but-3-ynyl-1-(2-cyclohexylethyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one.
| Compound Name | 4-but-3-ynyl-1-(2-cyclohexylethyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one |
|---|---|
| PubChem CID | 19740800 |
| Molecular Formula | C29H32N6O |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 4-but-3-ynyl-1-(2-cyclohexylethyl)-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazol-2-one |
| SMILES | C#CCCc1cn(CCC2CCCCC2)c(=O)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C29H32N6O/c1-2-3-11-25-21-34(19-18-22-9-5-4-6-10-22)29(36)35(25)20-23-14-16-24(17-15-23)26-12-7-8-13-27(26)28-30-32-33-31-28/h1,7-8,12-17,21-22H,3-6,9-11,18-20H2,(H,30,31,32,33) |
| InChIKey | ZNHJLFQBADPEGK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|