C24H28N2O2 — CID 142249836
1-benzyl-3-[(E)-but-2-enyl]-4-[3-(4-hydroxycyclohepta-1,3,6-trien-1-yl)propyl]imidazol-2-one (PubChem CID 142249836) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-benzyl-3-[(E)-but-2-enyl]-4-[3-(4-hydroxycyclohepta-1,3,6-trien-1-yl)propyl]imidazol-2-one.
| Compound Name | 1-benzyl-3-[(E)-but-2-enyl]-4-[3-(4-hydroxycyclohepta-1,3,6-trien-1-yl)propyl]imidazol-2-one |
|---|---|
| PubChem CID | 142249836 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-benzyl-3-[(E)-but-2-enyl]-4-[3-(4-hydroxycyclohepta-1,3,6-trien-1-yl)propyl]imidazol-2-one |
| SMILES | C/C=C/Cn1c(CCCC2=CC=C(O)CC=C2)cn(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C24H28N2O2/c1-2-3-17-26-22(13-7-11-20-12-8-14-23(27)16-15-20)19-25(24(26)28)18-21-9-5-4-6-10-21/h2-6,8-10,12,15-16,19,27H,7,11,13-14,17-18H2,1H3/b3-2+ |
| InChIKey | DSXOTVNHYBFVEA-NSCUHMNNSA-N |
| XLogP | 4.93 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|