C12H26N2 — CID 142250956
3,4-dimethyl-2,7-dihydroazepin-1-amine;ethane (PubChem CID 142250956) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is 3,4-dimethyl-2,7-dihydroazepin-1-amine;ethane.
| Compound Name | 3,4-dimethyl-2,7-dihydroazepin-1-amine;ethane |
|---|---|
| PubChem CID | 142250956 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 3,4-dimethyl-2,7-dihydroazepin-1-amine;ethane |
| SMILES | CC.CC.CC1=C(C)CN(N)CC=C1 |
| InChI | InChI=1S/C8H14N2.2C2H6/c1-7-4-3-5-10(9)6-8(7)2;2*1-2/h3-4H,5-6,9H2,1-2H3;2*1-2H3 |
| InChIKey | VYPMQYVUSNVIMD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|