C12H20N2 — CID 123223270
2-[(3,3-dimethylcyclohepta-1,4,6-trien-1-yl)methyl]-1,1-dimethylhydrazine (PubChem CID 123223270) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2-[(3,3-dimethylcyclohepta-1,4,6-trien-1-yl)methyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[(3,3-dimethylcyclohepta-1,4,6-trien-1-yl)methyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 123223270 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-[(3,3-dimethylcyclohepta-1,4,6-trien-1-yl)methyl]-1,1-dimethylhydrazine |
| SMILES | CN(C)NCC1=CC(C)(C)C=CC=C1 |
| InChI | InChI=1S/C12H20N2/c1-12(2)8-6-5-7-11(9-12)10-13-14(3)4/h5-9,13H,10H2,1-4H3 |
| InChIKey | DMSRVUDNRXSGEA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|