C11H18N2 — CID 123192867
1-[(3,3-dimethylcyclohepta-1,4,6-trien-1-yl)methyl]-2-methylhydrazine (PubChem CID 123192867) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-[(3,3-dimethylcyclohepta-1,4,6-trien-1-yl)methyl]-2-methylhydrazine.
| Compound Name | 1-[(3,3-dimethylcyclohepta-1,4,6-trien-1-yl)methyl]-2-methylhydrazine |
|---|---|
| PubChem CID | 123192867 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-[(3,3-dimethylcyclohepta-1,4,6-trien-1-yl)methyl]-2-methylhydrazine |
| SMILES | CNNCC1=CC(C)(C)C=CC=C1 |
| InChI | InChI=1S/C11H18N2/c1-11(2)7-5-4-6-10(8-11)9-13-12-3/h4-8,12-13H,9H2,1-3H3 |
| InChIKey | YBHJOJWOZPWNAP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|