C10H16N2 — CID 123813713
(3,3-dimethylcyclohepta-1,4,6-trien-1-yl)methylhydrazine (PubChem CID 123813713) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (3,3-dimethylcyclohepta-1,4,6-trien-1-yl)methylhydrazine.
| Compound Name | (3,3-dimethylcyclohepta-1,4,6-trien-1-yl)methylhydrazine |
|---|---|
| PubChem CID | 123813713 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (3,3-dimethylcyclohepta-1,4,6-trien-1-yl)methylhydrazine |
| SMILES | CC1(C)C=CC=CC(CNN)=C1 |
| InChI | InChI=1S/C10H16N2/c1-10(2)6-4-3-5-9(7-10)8-12-11/h3-7,12H,8,11H2,1-2H3 |
| InChIKey | BESSYNNSUVLNNH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|