C32H34BrN7O — CID 142251963
4-[6-(2-bromoethylideneamino)-7-ethyl-8-[(2-methylimidazol-1-yl)methyl]-5H-benzo[7]annulen-5-yl]-N-(4-cyanophenyl)piperazine-1-carboxamide (PubChem CID 142251963) has the molecular formula C32H34BrN7O and a molecular weight of 612.58 g/mol. Its IUPAC name is 4-[6-(2-bromoethylideneamino)-7-ethyl-8-[(2-methylimidazol-1-yl)methyl]-5H-benzo[7]annulen-5-yl]-N-(4-cyanophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[6-(2-bromoethylideneamino)-7-ethyl-8-[(2-methylimidazol-1-yl)methyl]-5H-benzo[7]annulen-5-yl]-N-(4-cyanophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 142251963 |
| Molecular Formula | C32H34BrN7O |
| Molecular Weight | 612.58 g/mol |
| Exact Mass | 611.20 |
| IUPAC Name | 4-[6-(2-bromoethylideneamino)-7-ethyl-8-[(2-methylimidazol-1-yl)methyl]-5H-benzo[7]annulen-5-yl]-N-(4-cyanophenyl)piperazine-1-carboxamide |
| SMILES | CCC1=C(/N=C/CBr)C(N2CCN(C(=O)Nc3ccc(C#N)cc3)CC2)c2ccccc2C=C1Cn1ccnc1C |
| InChI | InChI=1S/C32H34BrN7O/c1-3-28-26(22-40-15-14-35-23(40)2)20-25-6-4-5-7-29(25)31(30(28)36-13-12-33)38-16-18-39(19-17-38)32(41)37-27-10-8-24(21-34)9-11-27/h4-11,13-15,20,31H,3,12,16-19,22H2,1-2H3,(H,37,41)/b36-13+ |
| InChIKey | RYQONSXVSQRRLW-FIFHTESVSA-N |
| XLogP | 6.18 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|