C19H26FNO8 — CID 142252927
[(5R,9S,11R)-5-fluoro-5,9,11,13-tetramethyl-4,6,12,16-tetraoxo-3,17-dioxa-15-azabicyclo[12.3.0]heptadecan-9-yl] formate (PubChem CID 142252927) has the molecular formula C19H26FNO8 and a molecular weight of 415.41 g/mol. Its IUPAC name is [(5R,9S,11R)-5-fluoro-5,9,11,13-tetramethyl-4,6,12,16-tetraoxo-3,17-dioxa-15-azabicyclo[12.3.0]heptadecan-9-yl] formate.
| Compound Name | [(5R,9S,11R)-5-fluoro-5,9,11,13-tetramethyl-4,6,12,16-tetraoxo-3,17-dioxa-15-azabicyclo[12.3.0]heptadecan-9-yl] formate |
|---|---|
| PubChem CID | 142252927 |
| Molecular Formula | C19H26FNO8 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | [(5R,9S,11R)-5-fluoro-5,9,11,13-tetramethyl-4,6,12,16-tetraoxo-3,17-dioxa-15-azabicyclo[12.3.0]heptadecan-9-yl] formate |
| SMILES | CC1C(=O)[C@H](C)C[C@@](C)(OC=O)CCC(=O)[C@@](C)(F)C(=O)OCC2OC(=O)NC21 |
| InChI | InChI=1S/C19H26FNO8/c1-10-7-18(3,28-9-22)6-5-13(23)19(4,20)16(25)27-8-12-14(11(2)15(10)24)21-17(26)29-12/h9-12,14H,5-8H2,1-4H3,(H,21,26)/t10-,11?,12?,14?,18+,19-/m1/s1 |
| InChIKey | VMYQETVXDFHWJC-OLAMTEFJSA-N |
| XLogP | 1.26 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|