C8H9F3N2 — CID 142253950
2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine (PubChem CID 142253950) has the molecular formula C8H9F3N2 and a molecular weight of 190.17 g/mol. Its IUPAC name is 2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine.
| Compound Name | 2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine |
|---|---|
| PubChem CID | 142253950 |
| Molecular Formula | C8H9F3N2 |
| Molecular Weight | 190.17 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine |
| SMILES | CC1=CN=CC(C)(C(F)(F)F)N=C1 |
| InChI | InChI=1S/C8H9F3N2/c1-6-3-12-5-7(2,13-4-6)8(9,10)11/h3-5H,1-2H3 |
| InChIKey | GSICMCQYHWJCQC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.17 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |