About 2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine
2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine (PubChem CID 142253950) has the molecular formula C8H9F3N2
and a molecular weight of 190.17 g/mol. Its IUPAC name is 2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine.
Molecular Properties
| Compound Name | 2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine |
| PubChem CID | 142253950 |
| Molecular Formula | C8H9F3N2 |
| Molecular Weight | 190.17 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine |
| SMILES | CC1=CN=CC(C)(C(F)(F)F)N=C1 |
| InChI | InChI=1S/C8H9F3N2/c1-6-3-12-5-7(2,13-4-6)8(9,10)11/h3-5H,1-2H3 |
| InChIKey | GSICMCQYHWJCQC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.17 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine?
The IUPAC name of 2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine (CID 142253950) is 2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine.
What is the SMILES notation for 2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine?
The canonical SMILES for 2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine is CC1=CN=CC(C)(C(F)(F)F)N=C1.
What is the InChIKey of 2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine?
The InChIKey is GSICMCQYHWJCQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2/c1-6-3-12-5-7(2,13-4-6)8(9,10)11/h3-5H,1-2H3.
What are the key properties of 2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine?
2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine has a molecular weight of 190.17 g/mol, XLogP of 2.37, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-2-(trifluoromethyl)-1,4-diazepine is sourced from PubChem (CID 142253950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).