C17H18O2 — CID 142254460
2-[(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienyl]-5-methyl-1-benzofuran (PubChem CID 142254460) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-[(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienyl]-5-methyl-1-benzofuran.
| Compound Name | 2-[(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienyl]-5-methyl-1-benzofuran |
|---|---|
| PubChem CID | 142254460 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-[(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienyl]-5-methyl-1-benzofuran |
| SMILES | C/C=C\C(=C/C=C/c1cc2cc(C)ccc2o1)OC |
| InChI | InChI=1S/C17H18O2/c1-4-6-15(18-3)7-5-8-16-12-14-11-13(2)9-10-17(14)19-16/h4-12H,1-3H3/b6-4-,8-5+,15-7+ |
| InChIKey | QPLYTCYIJJIFFS-ZAYYWFBMSA-N |
| XLogP | 4.86 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|