C27H48O — CID 142254799
(4aR,7S,8aS)-7-ethyl-4a,7,8-trimethyl-9-(4-methylpentyl)-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one;ethane (PubChem CID 142254799) has the molecular formula C27H48O and a molecular weight of 388.68 g/mol. Its IUPAC name is (4aR,7S,8aS)-7-ethyl-4a,7,8-trimethyl-9-(4-methylpentyl)-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one;ethane.
| Compound Name | (4aR,7S,8aS)-7-ethyl-4a,7,8-trimethyl-9-(4-methylpentyl)-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one;ethane |
|---|---|
| PubChem CID | 142254799 |
| Molecular Formula | C27H48O |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 388.37 |
| IUPAC Name | (4aR,7S,8aS)-7-ethyl-4a,7,8-trimethyl-9-(4-methylpentyl)-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one;ethane |
| SMILES | CC.CC[C@@]1(C)CCC2[C@@H](C(CCCC(C)C)CC3=CC(=O)CC[C@@]32C)C1C |
| InChI | InChI=1S/C25H42O.C2H6/c1-7-24(5)13-12-22-23(18(24)4)19(10-8-9-17(2)3)15-20-16-21(26)11-14-25(20,22)6;1-2/h16-19,22-23H,7-15H2,1-6H3;1-2H3/t18?,19?,22?,23-,24+,25+;/m1./s1 |
| InChIKey | XVQVWOCYFTULFQ-POHGPXNQSA-N |
| XLogP | 8.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |