C15H31IO2 — CID 142256973
iodomethane;4-(4-methoxycyclohexyl)-2,4-dimethylpentan-2-ol (PubChem CID 142256973) has the molecular formula C15H31IO2 and a molecular weight of 370.32 g/mol. Its IUPAC name is iodomethane;4-(4-methoxycyclohexyl)-2,4-dimethylpentan-2-ol.
| Compound Name | iodomethane;4-(4-methoxycyclohexyl)-2,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 142256973 |
| Molecular Formula | C15H31IO2 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | iodomethane;4-(4-methoxycyclohexyl)-2,4-dimethylpentan-2-ol |
| SMILES | CI.COC1CCC(C(C)(C)CC(C)(C)O)CC1 |
| InChI | InChI=1S/C14H28O2.CH3I/c1-13(2,10-14(3,4)15)11-6-8-12(16-5)9-7-11;1-2/h11-12,15H,6-10H2,1-5H3;1H3 |
| InChIKey | ZQBCYFGVPCWHHR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|