C16H32O — CID 162054720
1-methoxy-4-(2,5,5-trimethylhexan-2-yl)cyclohexane (PubChem CID 162054720) has the molecular formula C16H32O and a molecular weight of 240.43 g/mol. Its IUPAC name is 1-methoxy-4-(2,5,5-trimethylhexan-2-yl)cyclohexane.
| Compound Name | 1-methoxy-4-(2,5,5-trimethylhexan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 162054720 |
| Molecular Formula | C16H32O |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.25 |
| IUPAC Name | 1-methoxy-4-(2,5,5-trimethylhexan-2-yl)cyclohexane |
| SMILES | COC1CCC(C(C)(C)CCC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H32O/c1-15(2,3)11-12-16(4,5)13-7-9-14(17-6)10-8-13/h13-14H,7-12H2,1-6H3 |
| InChIKey | YZAGYOXAUMLEJQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |