C18H26F2N2O2 — CID 142257983
methyl 2,5-difluoro-4-(4-pentyl-1,4-diazepan-1-yl)benzoate (PubChem CID 142257983) has the molecular formula C18H26F2N2O2 and a molecular weight of 340.41 g/mol. Its IUPAC name is methyl 2,5-difluoro-4-(4-pentyl-1,4-diazepan-1-yl)benzoate.
| Compound Name | methyl 2,5-difluoro-4-(4-pentyl-1,4-diazepan-1-yl)benzoate |
|---|---|
| PubChem CID | 142257983 |
| Molecular Formula | C18H26F2N2O2 |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | methyl 2,5-difluoro-4-(4-pentyl-1,4-diazepan-1-yl)benzoate |
| SMILES | CCCCCN1CCCN(c2cc(F)c(C(=O)OC)cc2F)CC1 |
| InChI | InChI=1S/C18H26F2N2O2/c1-3-4-5-7-21-8-6-9-22(11-10-21)17-13-15(19)14(12-16(17)20)18(23)24-2/h12-13H,3-11H2,1-2H3 |
| InChIKey | AKJDOPANHNMFGV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|