C20H27Cl2N3 — CID 142257992
1-benzhydryl-2,3,4,6,7,8,9,9a-octahydro-1H-pyrazino[1,2-a]pyrazine;dihydrochloride (PubChem CID 142257992) has the molecular formula C20H27Cl2N3 and a molecular weight of 380.36 g/mol. Its IUPAC name is 1-benzhydryl-2,3,4,6,7,8,9,9a-octahydro-1H-pyrazino[1,2-a]pyrazine;dihydrochloride.
| Compound Name | 1-benzhydryl-2,3,4,6,7,8,9,9a-octahydro-1H-pyrazino[1,2-a]pyrazine;dihydrochloride |
|---|---|
| PubChem CID | 142257992 |
| Molecular Formula | C20H27Cl2N3 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1-benzhydryl-2,3,4,6,7,8,9,9a-octahydro-1H-pyrazino[1,2-a]pyrazine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(C(c2ccccc2)C2NCCN3CCNCC23)cc1 |
| InChI | InChI=1S/C20H25N3.2ClH/c1-3-7-16(8-4-1)19(17-9-5-2-6-10-17)20-18-15-21-11-13-23(18)14-12-22-20;;/h1-10,18-22H,11-15H2;2*1H |
| InChIKey | QMGLMBQMHQKLJX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |