C19H21IN2O — CID 69269178
1-(2-iodopiperazin-1-yl)-3,3-diphenylpropan-1-one (PubChem CID 69269178) has the molecular formula C19H21IN2O and a molecular weight of 420.29 g/mol. Its IUPAC name is 1-(2-iodopiperazin-1-yl)-3,3-diphenylpropan-1-one.
| Compound Name | 1-(2-iodopiperazin-1-yl)-3,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 69269178 |
| Molecular Formula | C19H21IN2O |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 1-(2-iodopiperazin-1-yl)-3,3-diphenylpropan-1-one |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)N1CCNCC1I |
| InChI | InChI=1S/C19H21IN2O/c20-18-14-21-11-12-22(18)19(23)13-17(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-18,21H,11-14H2 |
| InChIKey | ORFCNLAKPHTMPP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|