C20H24N2O2 — CID 123226657
1-(3-hydroxy-2-methylpiperazin-1-yl)-3,3-diphenylpropan-1-one (PubChem CID 123226657) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-(3-hydroxy-2-methylpiperazin-1-yl)-3,3-diphenylpropan-1-one.
| Compound Name | 1-(3-hydroxy-2-methylpiperazin-1-yl)-3,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 123226657 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1-(3-hydroxy-2-methylpiperazin-1-yl)-3,3-diphenylpropan-1-one |
| SMILES | CC1C(O)NCCN1C(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O2/c1-15-20(24)21-12-13-22(15)19(23)14-18(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,15,18,20-21,24H,12-14H2,1H3 |
| InChIKey | WKURSLUPQLKLBB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |