C17H18Cl2N2 — CID 154433424
2-benzhydryl-3,5-dichloropiperazine (PubChem CID 154433424) has the molecular formula C17H18Cl2N2 and a molecular weight of 321.25 g/mol. Its IUPAC name is 2-benzhydryl-3,5-dichloropiperazine.
| Compound Name | 2-benzhydryl-3,5-dichloropiperazine |
|---|---|
| PubChem CID | 154433424 |
| Molecular Formula | C17H18Cl2N2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-benzhydryl-3,5-dichloropiperazine |
| SMILES | ClC1CNC(C(c2ccccc2)c2ccccc2)C(Cl)N1 |
| InChI | InChI=1S/C17H18Cl2N2/c18-14-11-20-16(17(19)21-14)15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,14-17,20-21H,11H2 |
| InChIKey | PMSQOJYLEYUEBL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|