About ethanol;3-(1-phenylethyl)azetidine
ethanol;3-(1-phenylethyl)azetidine (PubChem CID 19888360) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is ethanol;3-(1-phenylethyl)azetidine.
Molecular Properties
| Compound Name | ethanol;3-(1-phenylethyl)azetidine |
| PubChem CID | 19888360 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | ethanol;3-(1-phenylethyl)azetidine |
| SMILES | CC(c1ccccc1)C1CNC1.CCO |
| InChI | InChI=1S/C11H15N.C2H6O/c1-9(11-7-12-8-11)10-5-3-2-4-6-10;1-2-3/h2-6,9,11-12H,7-8H2,1H3;3H,2H2,1H3 |
| InChIKey | QROCPHUXDNPOIA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethanol;3-(1-phenylethyl)azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;3-(1-phenylethyl)azetidine?
The IUPAC name of ethanol;3-(1-phenylethyl)azetidine (CID 19888360) is ethanol;3-(1-phenylethyl)azetidine.
What is the SMILES notation for ethanol;3-(1-phenylethyl)azetidine?
The canonical SMILES for ethanol;3-(1-phenylethyl)azetidine is CC(c1ccccc1)C1CNC1.CCO.
What is the InChIKey of ethanol;3-(1-phenylethyl)azetidine?
The InChIKey is QROCPHUXDNPOIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.C2H6O/c1-9(11-7-12-8-11)10-5-3-2-4-6-10;1-2-3/h2-6,9,11-12H,7-8H2,1H3;3H,2H2,1H3.
What are the key properties of ethanol;3-(1-phenylethyl)azetidine?
ethanol;3-(1-phenylethyl)azetidine has a molecular weight of 207.32 g/mol, XLogP of 2.01, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;3-(1-phenylethyl)azetidine is sourced from PubChem (CID 19888360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).