C18H21NO2 — CID 142258421
2-cyclohexa-1,5-dien-1-yl-7-methoxy-1H-quinolin-4-one;ethane (PubChem CID 142258421) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-7-methoxy-1H-quinolin-4-one;ethane.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-7-methoxy-1H-quinolin-4-one;ethane |
|---|---|
| PubChem CID | 142258421 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-7-methoxy-1H-quinolin-4-one;ethane |
| SMILES | CC.COc1ccc2c(=O)cc(C3=CCCC=C3)[nH]c2c1 |
| InChI | InChI=1S/C16H15NO2.C2H6/c1-19-12-7-8-13-15(9-12)17-14(10-16(13)18)11-5-3-2-4-6-11;1-2/h3,5-10H,2,4H2,1H3,(H,17,18);1-2H3 |
| InChIKey | CXZSFHBYZNJDHV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |