C17H19N3O2S — CID 143362238
7-methoxy-2-(5-propan-2-ylimino-4H-1,4-thiazin-3-yl)-1H-quinolin-4-one (PubChem CID 143362238) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is 7-methoxy-2-(5-propan-2-ylimino-4H-1,4-thiazin-3-yl)-1H-quinolin-4-one.
| Compound Name | 7-methoxy-2-(5-propan-2-ylimino-4H-1,4-thiazin-3-yl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 143362238 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 7-methoxy-2-(5-propan-2-ylimino-4H-1,4-thiazin-3-yl)-1H-quinolin-4-one |
| SMILES | COc1ccc2c(=O)cc(C3=CSC/C(=N\C(C)C)N3)[nH]c2c1 |
| InChI | InChI=1S/C17H19N3O2S/c1-10(2)18-17-9-23-8-15(20-17)14-7-16(21)12-5-4-11(22-3)6-13(12)19-14/h4-8,10H,9H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | CARJJCXWDDOEFB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|