C16H16AsN2O2S — CID 87689938
CID 87689938 (PubChem CID 87689938) has the molecular formula C16H16AsN2O2S and a molecular weight of 375.31 g/mol.
| Compound Name | CID 87689938 |
|---|---|
| PubChem CID | 87689938 |
| Molecular Formula | C16H16AsN2O2S |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | — |
| SMILES | COc1ccc2c(=O)cc(-c3csc([As]C(C)C)n3)[nH]c2c1 |
| InChI | InChI=1S/C16H16AsN2O2S/c1-9(2)17-16-19-14(8-22-16)13-7-15(20)11-5-4-10(21-3)6-12(11)18-13/h4-9H,1-3H3,(H,18,20) |
| InChIKey | CPRKZZBNNHOSSZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|