C15H20N2 — CID 142258441
ethane;2-methyl-2,3-dihydro-1H-pyrimido[1,2-a]quinoline (PubChem CID 142258441) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is ethane;2-methyl-2,3-dihydro-1H-pyrimido[1,2-a]quinoline.
| Compound Name | ethane;2-methyl-2,3-dihydro-1H-pyrimido[1,2-a]quinoline |
|---|---|
| PubChem CID | 142258441 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | ethane;2-methyl-2,3-dihydro-1H-pyrimido[1,2-a]quinoline |
| SMILES | CC.CC1CN=C2C=Cc3ccccc3N2C1 |
| InChI | InChI=1S/C13H14N2.C2H6/c1-10-8-14-13-7-6-11-4-2-3-5-12(11)15(13)9-10;1-2/h2-7,10H,8-9H2,1H3;1-2H3 |
| InChIKey | WJWSIRZEPRFBLI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |