C21H16N2 — CID 11687979
(2R)-2-naphthalen-2-yl-1,2-dihydroimidazo[1,2-a]quinoline (PubChem CID 11687979) has the molecular formula C21H16N2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (2R)-2-naphthalen-2-yl-1,2-dihydroimidazo[1,2-a]quinoline.
| Compound Name | (2R)-2-naphthalen-2-yl-1,2-dihydroimidazo[1,2-a]quinoline |
|---|---|
| PubChem CID | 11687979 |
| Molecular Formula | C21H16N2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (2R)-2-naphthalen-2-yl-1,2-dihydroimidazo[1,2-a]quinoline |
| SMILES | C1=Cc2ccccc2N2C[C@@H](c3ccc4ccccc4c3)N=C12 |
| InChI | InChI=1S/C21H16N2/c1-2-7-17-13-18(10-9-15(17)5-1)19-14-23-20-8-4-3-6-16(20)11-12-21(23)22-19/h1-13,19H,14H2/t19-/m0/s1 |
| InChIKey | HMGFIQMSIOMJMC-IBGZPJMESA-N |
| XLogP | 4.83 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |