C25H42O2 — CID 142259635
1-[4-[[(2R)-4-ethyl-4-methyl-3-(2-methylprop-2-enyl)oxolan-2-yl]methyl]-5,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethanone (PubChem CID 142259635) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is 1-[4-[[(2R)-4-ethyl-4-methyl-3-(2-methylprop-2-enyl)oxolan-2-yl]methyl]-5,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethanone.
| Compound Name | 1-[4-[[(2R)-4-ethyl-4-methyl-3-(2-methylprop-2-enyl)oxolan-2-yl]methyl]-5,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethanone |
|---|---|
| PubChem CID | 142259635 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | 1-[4-[[(2R)-4-ethyl-4-methyl-3-(2-methylprop-2-enyl)oxolan-2-yl]methyl]-5,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethanone |
| SMILES | C=C(C)CC1[C@@H](CC2C(C)CCC3(C)C(C(C)=O)CCC23)OCC1(C)CC |
| InChI | InChI=1S/C25H42O2/c1-8-24(6)15-27-23(22(24)13-16(2)3)14-19-17(4)11-12-25(7)20(18(5)26)9-10-21(19)25/h17,19-23H,2,8-15H2,1,3-7H3/t17?,19?,20?,21?,22?,23-,24?,25?/m1/s1 |
| InChIKey | OKNVCNZJWADFBG-DVBOMMKESA-N |
| XLogP | 6.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|