C23H37ClO3 — CID 142168103
1-[4-[(7a-chloro-6-hydroxy-3a-methyl-1,3,4,5,6,7-hexahydro-2-benzofuran-1-yl)methyl]-5,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethanone (PubChem CID 142168103) has the molecular formula C23H37ClO3 and a molecular weight of 397.00 g/mol. Its IUPAC name is 1-[4-[(7a-chloro-6-hydroxy-3a-methyl-1,3,4,5,6,7-hexahydro-2-benzofuran-1-yl)methyl]-5,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethanone.
| Compound Name | 1-[4-[(7a-chloro-6-hydroxy-3a-methyl-1,3,4,5,6,7-hexahydro-2-benzofuran-1-yl)methyl]-5,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethanone |
|---|---|
| PubChem CID | 142168103 |
| Molecular Formula | C23H37ClO3 |
| Molecular Weight | 397.00 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 1-[4-[(7a-chloro-6-hydroxy-3a-methyl-1,3,4,5,6,7-hexahydro-2-benzofuran-1-yl)methyl]-5,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]ethanone |
| SMILES | CC(=O)C1CCC2C(CC3OCC4(C)CCC(O)CC34Cl)C(C)CCC12C |
| InChI | InChI=1S/C23H37ClO3/c1-14-7-10-22(4)18(15(2)25)5-6-19(22)17(14)11-20-23(24)12-16(26)8-9-21(23,3)13-27-20/h14,16-20,26H,5-13H2,1-4H3 |
| InChIKey | BATQWUWFEBMPCN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.00 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|