C15H26N2O3 — CID 142260539
N,N-diethyl-2-(4-nitrocyclohepta-1,3,5-trien-1-yl)oxyethanamine;ethane (PubChem CID 142260539) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is N,N-diethyl-2-(4-nitrocyclohepta-1,3,5-trien-1-yl)oxyethanamine;ethane.
| Compound Name | N,N-diethyl-2-(4-nitrocyclohepta-1,3,5-trien-1-yl)oxyethanamine;ethane |
|---|---|
| PubChem CID | 142260539 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N,N-diethyl-2-(4-nitrocyclohepta-1,3,5-trien-1-yl)oxyethanamine;ethane |
| SMILES | CC.CCN(CC)CCOC1=CC=C([N+](=O)[O-])C=CC1 |
| InChI | InChI=1S/C13H20N2O3.C2H6/c1-3-14(4-2)10-11-18-13-7-5-6-12(8-9-13)15(16)17;1-2/h5-6,8-9H,3-4,7,10-11H2,1-2H3;1-2H3 |
| InChIKey | WMICUPMZCQTLPM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|