C16H28N2O4 — CID 143202045
ethane;2-methoxy-N-(2-methoxyethyl)-N-[(5-nitrocyclohepta-1,4,6-trien-1-yl)methyl]ethanamine (PubChem CID 143202045) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is ethane;2-methoxy-N-(2-methoxyethyl)-N-[(5-nitrocyclohepta-1,4,6-trien-1-yl)methyl]ethanamine.
| Compound Name | ethane;2-methoxy-N-(2-methoxyethyl)-N-[(5-nitrocyclohepta-1,4,6-trien-1-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 143202045 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | ethane;2-methoxy-N-(2-methoxyethyl)-N-[(5-nitrocyclohepta-1,4,6-trien-1-yl)methyl]ethanamine |
| SMILES | CC.COCCN(CCOC)CC1=CCC=C([N+](=O)[O-])C=C1 |
| InChI | InChI=1S/C14H22N2O4.C2H6/c1-19-10-8-15(9-11-20-2)12-13-4-3-5-14(7-6-13)16(17)18;1-2/h4-7H,3,8-12H2,1-2H3;1-2H3 |
| InChIKey | NZJPFFISKGPYJJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|