About iodo 4-methylbenzoate;methanamine
iodo 4-methylbenzoate;methanamine (PubChem CID 142260547) has the molecular formula C9H12INO2
and a molecular weight of 293.10 g/mol. Its IUPAC name is iodo 4-methylbenzoate;methanamine.
Molecular Properties
| Compound Name | iodo 4-methylbenzoate;methanamine |
| PubChem CID | 142260547 |
| Molecular Formula | C9H12INO2 |
| Molecular Weight | 293.10 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | iodo 4-methylbenzoate;methanamine |
| SMILES | CN.Cc1ccc(C(=O)OI)cc1 |
| InChI | InChI=1S/C8H7IO2.CH5N/c1-6-2-4-7(5-3-6)8(10)11-9;1-2/h2-5H,1H3;2H2,1H3 |
| InChIKey | DCXMLZHAPNYLNZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.10 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodo 4-methylbenzoate;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodo 4-methylbenzoate;methanamine?
The IUPAC name of iodo 4-methylbenzoate;methanamine (CID 142260547) is iodo 4-methylbenzoate;methanamine.
What is the SMILES notation for iodo 4-methylbenzoate;methanamine?
The canonical SMILES for iodo 4-methylbenzoate;methanamine is CN.Cc1ccc(C(=O)OI)cc1.
What is the InChIKey of iodo 4-methylbenzoate;methanamine?
The InChIKey is DCXMLZHAPNYLNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7IO2.CH5N/c1-6-2-4-7(5-3-6)8(10)11-9;1-2/h2-5H,1H3;2H2,1H3.
What are the key properties of iodo 4-methylbenzoate;methanamine?
iodo 4-methylbenzoate;methanamine has a molecular weight of 293.10 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iodo 4-methylbenzoate;methanamine is sourced from PubChem (CID 142260547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).