About 1-(3-aminopropyl)-1,3-dihydro-2-benzofuran-5-carbonitrile;1-fluoro-4-methylbenzene
1-(3-aminopropyl)-1,3-dihydro-2-benzofuran-5-carbonitrile;1-fluoro-4-methylbenzene (PubChem CID 142260812) has the molecular formula C19H21FN2O
and a molecular weight of 312.39 g/mol. Its IUPAC name is 1-(3-aminopropyl)-1,3-dihydro-2-benzofuran-5-carbonitrile;1-fluoro-4-methylbenzene.
Molecular Properties
| Compound Name | 1-(3-aminopropyl)-1,3-dihydro-2-benzofuran-5-carbonitrile;1-fluoro-4-methylbenzene |
| PubChem CID | 142260812 |
| Molecular Formula | C19H21FN2O |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-(3-aminopropyl)-1,3-dihydro-2-benzofuran-5-carbonitrile;1-fluoro-4-methylbenzene |
| SMILES | Cc1ccc(F)cc1.N#Cc1ccc2c(c1)COC2CCCN |
| InChI | InChI=1S/C12H14N2O.C7H7F/c13-5-1-2-12-11-4-3-9(7-14)6-10(11)8-15-12;1-6-2-4-7(8)5-3-6/h3-4,6,12H,1-2,5,8,13H2;2-5H,1H3 |
| InChIKey | VEOOJJUFGUBCBB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-aminopropyl)-1,3-dihydro-2-benzofuran-5-carbonitrile;1-fluoro-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-aminopropyl)-1,3-dihydro-2-benzofuran-5-carbonitrile;1-fluoro-4-methylbenzene?
The IUPAC name of 1-(3-aminopropyl)-1,3-dihydro-2-benzofuran-5-carbonitrile;1-fluoro-4-methylbenzene (CID 142260812) is 1-(3-aminopropyl)-1,3-dihydro-2-benzofuran-5-carbonitrile;1-fluoro-4-methylbenzene.
What is the SMILES notation for 1-(3-aminopropyl)-1,3-dihydro-2-benzofuran-5-carbonitrile;1-fluoro-4-methylbenzene?
The canonical SMILES for 1-(3-aminopropyl)-1,3-dihydro-2-benzofuran-5-carbonitrile;1-fluoro-4-methylbenzene is Cc1ccc(F)cc1.N#Cc1ccc2c(c1)COC2CCCN.
What is the InChIKey of 1-(3-aminopropyl)-1,3-dihydro-2-benzofuran-5-carbonitrile;1-fluoro-4-methylbenzene?
The InChIKey is VEOOJJUFGUBCBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O.C7H7F/c13-5-1-2-12-11-4-3-9(7-14)6-10(11)8-15-12;1-6-2-4-7(8)5-3-6/h3-4,6,12H,1-2,5,8,13H2;2-5H,1H3.
What are the key properties of 1-(3-aminopropyl)-1,3-dihydro-2-benzofuran-5-carbonitrile;1-fluoro-4-methylbenzene?
1-(3-aminopropyl)-1,3-dihydro-2-benzofuran-5-carbonitrile;1-fluoro-4-methylbenzene has a molecular weight of 312.39 g/mol, XLogP of 4.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-aminopropyl)-1,3-dihydro-2-benzofuran-5-carbonitrile;1-fluoro-4-methylbenzene is sourced from PubChem (CID 142260812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).