C24H20N4O3S — CID 1422616
2-[(4-nitrophenyl)methylsulfanyl]-3-phenyl-6,7,8,9-tetrahydropyrimido[4,5-b]quinolin-4-one (PubChem CID 1422616) has the molecular formula C24H20N4O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is 2-[(4-nitrophenyl)methylsulfanyl]-3-phenyl-6,7,8,9-tetrahydropyrimido[4,5-b]quinolin-4-one.
| Compound Name | 2-[(4-nitrophenyl)methylsulfanyl]-3-phenyl-6,7,8,9-tetrahydropyrimido[4,5-b]quinolin-4-one |
|---|---|
| PubChem CID | 1422616 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 2-[(4-nitrophenyl)methylsulfanyl]-3-phenyl-6,7,8,9-tetrahydropyrimido[4,5-b]quinolin-4-one |
| SMILES | O=c1c2cc3c(nc2nc(SCc2ccc([N+](=O)[O-])cc2)n1-c1ccccc1)CCCC3 |
| InChI | InChI=1S/C24H20N4O3S/c29-23-20-14-17-6-4-5-9-21(17)25-22(20)26-24(27(23)18-7-2-1-3-8-18)32-15-16-10-12-19(13-11-16)28(30)31/h1-3,7-8,10-14H,4-6,9,15H2 |
| InChIKey | AECLFSCAZNNKHZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|