C21H29N3O2 — CID 142262331
ethane;ethyl 2-[(2Z,4Z)-2-aminohexa-2,4-dien-3-yl]-1H-benzimidazole-4-carboxylate;prop-1-yne (PubChem CID 142262331) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is ethane;ethyl 2-[(2Z,4Z)-2-aminohexa-2,4-dien-3-yl]-1H-benzimidazole-4-carboxylate;prop-1-yne.
| Compound Name | ethane;ethyl 2-[(2Z,4Z)-2-aminohexa-2,4-dien-3-yl]-1H-benzimidazole-4-carboxylate;prop-1-yne |
|---|---|
| PubChem CID | 142262331 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | ethane;ethyl 2-[(2Z,4Z)-2-aminohexa-2,4-dien-3-yl]-1H-benzimidazole-4-carboxylate;prop-1-yne |
| SMILES | C#CC.C/C=C\C(=C(/C)N)c1nc2c(C(=O)OCC)cccc2[nH]1.CC |
| InChI | InChI=1S/C16H19N3O2.C3H4.C2H6/c1-4-7-11(10(3)17)15-18-13-9-6-8-12(14(13)19-15)16(20)21-5-2;1-3-2;1-2/h4,6-9H,5,17H2,1-3H3,(H,18,19);1H,2H3;1-2H3/b7-4-,11-10-;; |
| InChIKey | TUBHFKULGKUFRK-PSTWVLAASA-N |
| XLogP | 4.67 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|