C18H36N2 — CID 142262723
ethane;N'-[(2E,4Z)-2-ethenyl-3-ethylhexa-2,4-dienyl]-N,N,N'-trimethylpropane-1,3-diamine (PubChem CID 142262723) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is ethane;N'-[(2E,4Z)-2-ethenyl-3-ethylhexa-2,4-dienyl]-N,N,N'-trimethylpropane-1,3-diamine.
| Compound Name | ethane;N'-[(2E,4Z)-2-ethenyl-3-ethylhexa-2,4-dienyl]-N,N,N'-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 142262723 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | ethane;N'-[(2E,4Z)-2-ethenyl-3-ethylhexa-2,4-dienyl]-N,N,N'-trimethylpropane-1,3-diamine |
| SMILES | C=C/C(CN(C)CCCN(C)C)=C(\C=C/C)CC.CC |
| InChI | InChI=1S/C16H30N2.C2H6/c1-7-11-15(8-2)16(9-3)14-18(6)13-10-12-17(4)5;1-2/h7,9,11H,3,8,10,12-14H2,1-2,4-6H3;1-2H3/b11-7-,16-15+; |
| InChIKey | WUQXZXGCDYQCMB-QVEDHVEMSA-N |
| XLogP | 4.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|