C22H32N2O4 — CID 142267383
formaldehyde;4-[(3-hydroxypropylamino)methyl]-N-[2-(4-methylphenyl)ethyl]benzamide;methanol (PubChem CID 142267383) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is formaldehyde;4-[(3-hydroxypropylamino)methyl]-N-[2-(4-methylphenyl)ethyl]benzamide;methanol.
| Compound Name | formaldehyde;4-[(3-hydroxypropylamino)methyl]-N-[2-(4-methylphenyl)ethyl]benzamide;methanol |
|---|---|
| PubChem CID | 142267383 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | formaldehyde;4-[(3-hydroxypropylamino)methyl]-N-[2-(4-methylphenyl)ethyl]benzamide;methanol |
| SMILES | C=O.CO.Cc1ccc(CCNC(=O)c2ccc(CNCCCO)cc2)cc1 |
| InChI | InChI=1S/C20H26N2O2.CH4O.CH2O/c1-16-3-5-17(6-4-16)11-13-22-20(24)19-9-7-18(8-10-19)15-21-12-2-14-23;2*1-2/h3-10,21,23H,2,11-15H2,1H3,(H,22,24);2H,1H3;1H2 |
| InChIKey | DJQZREPRMLVIER-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|