C12H19NO4 — CID 142268413
1-[(3aR,4S,6aS)-5-acetyl-2-ethyl-2-methyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethanone (PubChem CID 142268413) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-5-acetyl-2-ethyl-2-methyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethanone.
| Compound Name | 1-[(3aR,4S,6aS)-5-acetyl-2-ethyl-2-methyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethanone |
|---|---|
| PubChem CID | 142268413 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 1-[(3aR,4S,6aS)-5-acetyl-2-ethyl-2-methyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethanone |
| SMILES | CCC1(C)O[C@H]2[C@H](CN(C(C)=O)[C@@H]2C(C)=O)O1 |
| InChI | InChI=1S/C12H19NO4/c1-5-12(4)16-9-6-13(8(3)15)10(7(2)14)11(9)17-12/h9-11H,5-6H2,1-4H3/t9-,10+,11-,12?/m0/s1 |
| InChIKey | WJNCYALNAMVPKC-PSIUFMSWSA-N |
| XLogP | 0.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |