C38H67N2O3+ — CID 142268940
2-(dimethylamino)ethyl-[2-[[(1R,4R,5R,10S,13R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-yl]oxy]-2-oxoethyl]-dimethylazanium (PubChem CID 142268940) has the molecular formula C38H67N2O3+ and a molecular weight of 599.97 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl-[2-[[(1R,4R,5R,10S,13R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-yl]oxy]-2-oxoethyl]-dimethylazanium.
| Compound Name | 2-(dimethylamino)ethyl-[2-[[(1R,4R,5R,10S,13R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-yl]oxy]-2-oxoethyl]-dimethylazanium |
|---|---|
| PubChem CID | 142268940 |
| Molecular Formula | C38H67N2O3+ |
| Molecular Weight | 599.97 g/mol |
| Exact Mass | 599.51 |
| IUPAC Name | 2-(dimethylamino)ethyl-[2-[[(1R,4R,5R,10S,13R)-4,5,9,9,13,20,20-heptamethyl-24-oxahexacyclo[17.3.2.01,18.04,17.05,14.08,13]tetracosan-10-yl]oxy]-2-oxoethyl]-dimethylazanium |
| SMILES | CN(C)CC[N+](C)(C)CC(=O)O[C@H]1CC[C@@]2(C)C(CC[C@]3(C)C2CCC2C4C5OC[C@@]4(CCC5(C)C)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C38H67N2O3/c1-33(2)18-20-38-21-19-36(6)26(31(38)32(33)42-25-38)12-13-28-35(5)16-15-29(34(3,4)27(35)14-17-37(28,36)7)43-30(41)24-40(10,11)23-22-39(8)9/h26-29,31-32H,12-25H2,1-11H3/q+1/t26?,27?,28?,29-,31?,32?,35-,36+,37+,38+/m0/s1 |
| InChIKey | KBEGFJDBHWWQPF-WFSURSGESA-N |
| XLogP | 7.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.97 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|